C22H32N4O5 — CID 166105917
tert-butyl (2S)-2-[[(2S)-2-[[2-(dimethylamino)acetyl]amino]-2-phenylacetyl]amino]-6-imino-5-oxohexanoate (PubChem CID 166105917) has the molecular formula C22H32N4O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-2-[[2-(dimethylamino)acetyl]amino]-2-phenylacetyl]amino]-6-imino-5-oxohexanoate.
| Compound Name | tert-butyl (2S)-2-[[(2S)-2-[[2-(dimethylamino)acetyl]amino]-2-phenylacetyl]amino]-6-imino-5-oxohexanoate |
|---|---|
| PubChem CID | 166105917 |
| Molecular Formula | C22H32N4O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-2-[[2-(dimethylamino)acetyl]amino]-2-phenylacetyl]amino]-6-imino-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@@H](NC(=O)CN(C)C)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H32N4O5/c1-22(2,3)31-21(30)17(12-11-16(27)13-23)24-20(29)19(15-9-7-6-8-10-15)25-18(28)14-26(4)5/h6-10,13,17,19,23H,11-12,14H2,1-5H3,(H,24,29)(H,25,28)/b23-13+/t17-,19-/m0/s1 |
| InChIKey | VFSCVLKDOVJWGR-AGSFVOOMSA-N |
| XLogP | 1.23 |
| TPSA | 128.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|