C28H44N4O9 — CID 171550222
tert-butyl (2S)-2-[[(2S)-2-[[(4S)-4-acetamido-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]amino]-6-imino-5-oxohexanoyl]amino]-5-oxohept-6-enoate (PubChem CID 171550222) has the molecular formula C28H44N4O9 and a molecular weight of 580.68 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-2-[[(4S)-4-acetamido-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]amino]-6-imino-5-oxohexanoyl]amino]-5-oxohept-6-enoate.
| Compound Name | tert-butyl (2S)-2-[[(2S)-2-[[(4S)-4-acetamido-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]amino]-6-imino-5-oxohexanoyl]amino]-5-oxohept-6-enoate |
|---|---|
| PubChem CID | 171550222 |
| Molecular Formula | C28H44N4O9 |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-2-[[(4S)-4-acetamido-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]amino]-6-imino-5-oxohexanoyl]amino]-5-oxohept-6-enoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)CC[C@H](NC(C)=O)C(=O)OC(C)(C)C)C(=O)N[C@@H](CCC(=O)C=C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H44N4O9/c1-9-18(34)10-13-22(26(39)41-28(6,7)8)32-24(37)20(12-11-19(35)16-29)31-23(36)15-14-21(30-17(2)33)25(38)40-27(3,4)5/h9,16,20-22,29H,1,10-15H2,2-8H3,(H,30,33)(H,31,36)(H,32,37)/b29-16+/t20-,21-,22-/m0/s1 |
| InChIKey | DUCLEJYRJXGNDL-ABMYTQQESA-N |
| XLogP | 1.46 |
| TPSA | 197.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|