C13H22N2O5 — CID 167015808
propan-2-yl (2S)-2-[[(2S)-3-hydroxy-2-methylpropanoyl]amino]-6-imino-5-oxohexanoate (PubChem CID 167015808) has the molecular formula C13H22N2O5 and a molecular weight of 286.33 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(2S)-3-hydroxy-2-methylpropanoyl]amino]-6-imino-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-2-[[(2S)-3-hydroxy-2-methylpropanoyl]amino]-6-imino-5-oxohexanoate |
|---|---|
| PubChem CID | 167015808 |
| Molecular Formula | C13H22N2O5 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | propan-2-yl (2S)-2-[[(2S)-3-hydroxy-2-methylpropanoyl]amino]-6-imino-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@@H](C)CO)C(=O)OC(C)C |
| InChI | InChI=1S/C13H22N2O5/c1-8(2)20-13(19)11(5-4-10(17)6-14)15-12(18)9(3)7-16/h6,8-9,11,14,16H,4-5,7H2,1-3H3,(H,15,18)/b14-6+/t9-,11-/m0/s1 |
| InChIKey | YWFIUMBHOMRQBV-KJRPWGRZSA-N |
| XLogP | 0.05 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|