C16H23N3O5 — CID 170445453
propan-2-yl (2S)-6-imino-2-[[(2S)-2-methoxy-2-(1H-pyrrol-2-yl)acetyl]amino]-5-oxohexanoate (PubChem CID 170445453) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is propan-2-yl (2S)-6-imino-2-[[(2S)-2-methoxy-2-(1H-pyrrol-2-yl)acetyl]amino]-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-6-imino-2-[[(2S)-2-methoxy-2-(1H-pyrrol-2-yl)acetyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 170445453 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | propan-2-yl (2S)-6-imino-2-[[(2S)-2-methoxy-2-(1H-pyrrol-2-yl)acetyl]amino]-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@@H](OC)c1ccc[nH]1)C(=O)OC(C)C |
| InChI | InChI=1S/C16H23N3O5/c1-10(2)24-16(22)13(7-6-11(20)9-17)19-15(21)14(23-3)12-5-4-8-18-12/h4-5,8-10,13-14,17-18H,6-7H2,1-3H3,(H,19,21)/b17-9+/t13-,14-/m0/s1 |
| InChIKey | VAMUFHSQNOYCHN-VLVDCKQDSA-N |
| XLogP | 1.14 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|