C18H24N2O5S — CID 167015403
propan-2-yl (2S)-6-imino-2-[[(2S)-2-methylsulfinyl-2-phenylacetyl]amino]-5-oxohexanoate (PubChem CID 167015403) has the molecular formula C18H24N2O5S and a molecular weight of 380.47 g/mol. Its IUPAC name is propan-2-yl (2S)-6-imino-2-[[(2S)-2-methylsulfinyl-2-phenylacetyl]amino]-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-6-imino-2-[[(2S)-2-methylsulfinyl-2-phenylacetyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 167015403 |
| Molecular Formula | C18H24N2O5S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | propan-2-yl (2S)-6-imino-2-[[(2S)-2-methylsulfinyl-2-phenylacetyl]amino]-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](c1ccccc1)S(C)=O)C(=O)OC(C)C |
| InChI | InChI=1S/C18H24N2O5S/c1-12(2)25-18(23)15(10-9-14(21)11-19)20-17(22)16(26(3)24)13-7-5-4-6-8-13/h4-8,11-12,15-16,19H,9-10H2,1-3H3,(H,20,22)/b19-11+/t15-,16-,26?/m0/s1 |
| InChIKey | ZMHBGTXMUFREKO-QWJBKXNUSA-N |
| XLogP | 1.54 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|