C22H29N3O5 — CID 167015206
propan-2-yl (2S)-6-imino-2-[[(2R)-2-methoxy-3-(1-methylindol-3-yl)propanoyl]amino]-5-oxohexanoate (PubChem CID 167015206) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is propan-2-yl (2S)-6-imino-2-[[(2R)-2-methoxy-3-(1-methylindol-3-yl)propanoyl]amino]-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-6-imino-2-[[(2R)-2-methoxy-3-(1-methylindol-3-yl)propanoyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 167015206 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | propan-2-yl (2S)-6-imino-2-[[(2R)-2-methoxy-3-(1-methylindol-3-yl)propanoyl]amino]-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@@H](Cc1cn(C)c2ccccc12)OC)C(=O)OC(C)C |
| InChI | InChI=1S/C22H29N3O5/c1-14(2)30-22(28)18(10-9-16(26)12-23)24-21(27)20(29-4)11-15-13-25(3)19-8-6-5-7-17(15)19/h5-8,12-14,18,20,23H,9-11H2,1-4H3,(H,24,27)/b23-12+/t18-,20+/m0/s1 |
| InChIKey | NLDLNNNDYAFKOF-OVIGCCJXSA-N |
| XLogP | 2.17 |
| TPSA | 110.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|