C22H28ClN3O5 — CID 170444898
propan-2-yl (2S)-2-[[(2S)-3-(7-chloro-1H-indol-3-yl)-2-methoxypropanoyl]amino]-7-imino-6-oxoheptanoate (PubChem CID 170444898) has the molecular formula C22H28ClN3O5 and a molecular weight of 449.94 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(2S)-3-(7-chloro-1H-indol-3-yl)-2-methoxypropanoyl]amino]-7-imino-6-oxoheptanoate.
| Compound Name | propan-2-yl (2S)-2-[[(2S)-3-(7-chloro-1H-indol-3-yl)-2-methoxypropanoyl]amino]-7-imino-6-oxoheptanoate |
|---|---|
| PubChem CID | 170444898 |
| Molecular Formula | C22H28ClN3O5 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | propan-2-yl (2S)-2-[[(2S)-3-(7-chloro-1H-indol-3-yl)-2-methoxypropanoyl]amino]-7-imino-6-oxoheptanoate |
| SMILES | [H]/N=C/C(=O)CCC[C@H](NC(=O)[C@H](Cc1c[nH]c2c(Cl)cccc12)OC)C(=O)OC(C)C |
| InChI | InChI=1S/C22H28ClN3O5/c1-13(2)31-22(29)18(9-4-6-15(27)11-24)26-21(28)19(30-3)10-14-12-25-20-16(14)7-5-8-17(20)23/h5,7-8,11-13,18-19,24-25H,4,6,9-10H2,1-3H3,(H,26,28)/b24-11+/t18-,19-/m0/s1 |
| InChIKey | TUXWHZBQKOIIAF-ACTAYPHLSA-N |
| XLogP | 3.20 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|