C22H29N4O6+ — CID 170532614
(E)-imino-[(5S)-5-[[(2S)-2-methoxy-3-(7-methoxy-1H-indol-3-yl)propanoyl]amino]-2,6-dioxo-6-propan-2-yloxyhexylidene]azanium (PubChem CID 170532614) has the molecular formula C22H29N4O6+ and a molecular weight of 445.50 g/mol. Its IUPAC name is (E)-imino-[(5S)-5-[[(2S)-2-methoxy-3-(7-methoxy-1H-indol-3-yl)propanoyl]amino]-2,6-dioxo-6-propan-2-yloxyhexylidene]azanium.
| Compound Name | (E)-imino-[(5S)-5-[[(2S)-2-methoxy-3-(7-methoxy-1H-indol-3-yl)propanoyl]amino]-2,6-dioxo-6-propan-2-yloxyhexylidene]azanium |
|---|---|
| PubChem CID | 170532614 |
| Molecular Formula | C22H29N4O6+ |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | (E)-imino-[(5S)-5-[[(2S)-2-methoxy-3-(7-methoxy-1H-indol-3-yl)propanoyl]amino]-2,6-dioxo-6-propan-2-yloxyhexylidene]azanium |
| SMILES | COc1cccc2c(C[C@H](OC)C(=O)N[C@@H](CCC(=O)C=[N+]=N)C(=O)OC(C)C)c[nH]c12 |
| InChI | InChI=1S/C22H28N4O6/c1-13(2)32-22(29)17(9-8-15(27)12-25-23)26-21(28)19(31-4)10-14-11-24-20-16(14)6-5-7-18(20)30-3/h5-7,11-13,17,19,23-24H,8-10H2,1-4H3/p+1/t17-,19-/m0/s1 |
| InChIKey | MVBYOAKPWOYSTJ-HKUYNNGSSA-O |
| XLogP | 1.83 |
| TPSA | 144.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|