C18H19FN4O5 — CID 170436882
6-diazo-2-[[3-(7-fluoro-1H-indol-3-yl)-2-methoxypropanoyl]amino]-5-oxohexanoic acid (PubChem CID 170436882) has the molecular formula C18H19FN4O5 and a molecular weight of 390.37 g/mol. Its IUPAC name is 6-diazo-2-[[3-(7-fluoro-1H-indol-3-yl)-2-methoxypropanoyl]amino]-5-oxohexanoic acid.
| Compound Name | 6-diazo-2-[[3-(7-fluoro-1H-indol-3-yl)-2-methoxypropanoyl]amino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 170436882 |
| Molecular Formula | C18H19FN4O5 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 6-diazo-2-[[3-(7-fluoro-1H-indol-3-yl)-2-methoxypropanoyl]amino]-5-oxohexanoic acid |
| SMILES | COC(Cc1c[nH]c2c(F)cccc12)C(=O)NC(CCC(=O)C=[N+]=[N-])C(=O)O |
| InChI | InChI=1S/C18H19FN4O5/c1-28-15(7-10-8-21-16-12(10)3-2-4-13(16)19)17(25)23-14(18(26)27)6-5-11(24)9-22-20/h2-4,8-9,14-15,21H,5-7H2,1H3,(H,23,25)(H,26,27) |
| InChIKey | XFLCQRICJPNNCY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 144.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|