C19H22N4O6 — CID 170436654
6-diazo-2-[[2-(2-hydroxyethoxy)-3-(1H-indol-3-yl)propanoyl]amino]-5-oxohexanoic acid (PubChem CID 170436654) has the molecular formula C19H22N4O6 and a molecular weight of 402.41 g/mol. Its IUPAC name is 6-diazo-2-[[2-(2-hydroxyethoxy)-3-(1H-indol-3-yl)propanoyl]amino]-5-oxohexanoic acid.
| Compound Name | 6-diazo-2-[[2-(2-hydroxyethoxy)-3-(1H-indol-3-yl)propanoyl]amino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 170436654 |
| Molecular Formula | C19H22N4O6 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 6-diazo-2-[[2-(2-hydroxyethoxy)-3-(1H-indol-3-yl)propanoyl]amino]-5-oxohexanoic acid |
| SMILES | [N-]=[N+]=CC(=O)CCC(NC(=O)C(Cc1c[nH]c2ccccc12)OCCO)C(=O)O |
| InChI | InChI=1S/C19H22N4O6/c20-22-11-13(25)5-6-16(19(27)28)23-18(26)17(29-8-7-24)9-12-10-21-15-4-2-1-3-14(12)15/h1-4,10-11,16-17,21,24H,5-9H2,(H,23,26)(H,27,28) |
| InChIKey | ASMPPWGBQBVFKI-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 165.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|