C17H17FN4O5 — CID 170436898
(2S)-6-diazo-2-[[(2S)-3-(6-fluoro-1H-indol-3-yl)-2-hydroxypropanoyl]amino]-5-oxohexanoic acid (PubChem CID 170436898) has the molecular formula C17H17FN4O5 and a molecular weight of 376.34 g/mol. Its IUPAC name is (2S)-6-diazo-2-[[(2S)-3-(6-fluoro-1H-indol-3-yl)-2-hydroxypropanoyl]amino]-5-oxohexanoic acid.
| Compound Name | (2S)-6-diazo-2-[[(2S)-3-(6-fluoro-1H-indol-3-yl)-2-hydroxypropanoyl]amino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 170436898 |
| Molecular Formula | C17H17FN4O5 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | (2S)-6-diazo-2-[[(2S)-3-(6-fluoro-1H-indol-3-yl)-2-hydroxypropanoyl]amino]-5-oxohexanoic acid |
| SMILES | [N-]=[N+]=CC(=O)CC[C@H](NC(=O)[C@@H](O)Cc1c[nH]c2cc(F)ccc12)C(=O)O |
| InChI | InChI=1S/C17H17FN4O5/c18-10-1-3-12-9(7-20-14(12)6-10)5-15(24)16(25)22-13(17(26)27)4-2-11(23)8-21-19/h1,3,6-8,13,15,20,24H,2,4-5H2,(H,22,25)(H,26,27)/t13-,15-/m0/s1 |
| InChIKey | PHTLGPHCRILANH-ZFWWWQNUSA-N |
| XLogP | 0.43 |
| TPSA | 155.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|