C18H17N5O5 — CID 170436801
2-[[3-(7-cyano-1H-indol-3-yl)-2-hydroxypropanoyl]amino]-6-diazo-5-oxohexanoic acid (PubChem CID 170436801) has the molecular formula C18H17N5O5 and a molecular weight of 383.36 g/mol. Its IUPAC name is 2-[[3-(7-cyano-1H-indol-3-yl)-2-hydroxypropanoyl]amino]-6-diazo-5-oxohexanoic acid.
| Compound Name | 2-[[3-(7-cyano-1H-indol-3-yl)-2-hydroxypropanoyl]amino]-6-diazo-5-oxohexanoic acid |
|---|---|
| PubChem CID | 170436801 |
| Molecular Formula | C18H17N5O5 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 2-[[3-(7-cyano-1H-indol-3-yl)-2-hydroxypropanoyl]amino]-6-diazo-5-oxohexanoic acid |
| SMILES | N#Cc1cccc2c(CC(O)C(=O)NC(CCC(=O)C=[N+]=[N-])C(=O)O)c[nH]c12 |
| InChI | InChI=1S/C18H17N5O5/c19-7-10-2-1-3-13-11(8-21-16(10)13)6-15(25)17(26)23-14(18(27)28)5-4-12(24)9-22-20/h1-3,8-9,14-15,21,25H,4-6H2,(H,23,26)(H,27,28) |
| InChIKey | CZWJCTLJXNDMQX-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 179.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|