C21H23N5O5 — CID 170532473
propan-2-yl (2S)-2-[[(2S)-3-(7-cyano-1H-indol-3-yl)-2-hydroxypropanoyl]amino]-6-diazo-5-oxohexanoate (PubChem CID 170532473) has the molecular formula C21H23N5O5 and a molecular weight of 425.45 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(2S)-3-(7-cyano-1H-indol-3-yl)-2-hydroxypropanoyl]amino]-6-diazo-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-2-[[(2S)-3-(7-cyano-1H-indol-3-yl)-2-hydroxypropanoyl]amino]-6-diazo-5-oxohexanoate |
|---|---|
| PubChem CID | 170532473 |
| Molecular Formula | C21H23N5O5 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | propan-2-yl (2S)-2-[[(2S)-3-(7-cyano-1H-indol-3-yl)-2-hydroxypropanoyl]amino]-6-diazo-5-oxohexanoate |
| SMILES | CC(C)OC(=O)[C@H](CCC(=O)C=[N+]=[N-])NC(=O)[C@@H](O)Cc1c[nH]c2c(C#N)cccc12 |
| InChI | InChI=1S/C21H23N5O5/c1-12(2)31-21(30)17(7-6-15(27)11-25-23)26-20(29)18(28)8-14-10-24-19-13(9-22)4-3-5-16(14)19/h3-5,10-12,17-18,24,28H,6-8H2,1-2H3,(H,26,29)/t17-,18-/m0/s1 |
| InChIKey | MBAKNPYVCJKNGK-ROUUACIJSA-N |
| XLogP | 1.03 |
| TPSA | 168.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|