C23H25N5O6 — CID 170532333
propan-2-yl (2S)-2-[[2-(2-cyanoacetyl)oxy-3-(1H-indol-3-yl)propanoyl]amino]-6-diazo-5-oxohexanoate (PubChem CID 170532333) has the molecular formula C23H25N5O6 and a molecular weight of 467.48 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[2-(2-cyanoacetyl)oxy-3-(1H-indol-3-yl)propanoyl]amino]-6-diazo-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-2-[[2-(2-cyanoacetyl)oxy-3-(1H-indol-3-yl)propanoyl]amino]-6-diazo-5-oxohexanoate |
|---|---|
| PubChem CID | 170532333 |
| Molecular Formula | C23H25N5O6 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | propan-2-yl (2S)-2-[[2-(2-cyanoacetyl)oxy-3-(1H-indol-3-yl)propanoyl]amino]-6-diazo-5-oxohexanoate |
| SMILES | CC(C)OC(=O)[C@H](CCC(=O)C=[N+]=[N-])NC(=O)C(Cc1c[nH]c2ccccc12)OC(=O)CC#N |
| InChI | InChI=1S/C23H25N5O6/c1-14(2)33-23(32)19(8-7-16(29)13-27-25)28-22(31)20(34-21(30)9-10-24)11-15-12-26-18-6-4-3-5-17(15)18/h3-6,12-14,19-20,26H,7-9,11H2,1-2H3,(H,28,31)/t19-,20?/m0/s1 |
| InChIKey | NUBJWEQFXGGWEX-XJDOXCRVSA-N |
| XLogP | 1.62 |
| TPSA | 174.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|