C24H30N3O5+ — CID 149073247
[(5S)-5-[[(2R)-2-(1H-indol-3-ylmethyl)-4-oxopentanoyl]amino]-2,6-dioxo-6-propan-2-yloxyhexylidene]-methylideneazanium (PubChem CID 149073247) has the molecular formula C24H30N3O5+ and a molecular weight of 440.52 g/mol. Its IUPAC name is [(5S)-5-[[(2R)-2-(1H-indol-3-ylmethyl)-4-oxopentanoyl]amino]-2,6-dioxo-6-propan-2-yloxyhexylidene]-methylideneazanium.
| Compound Name | [(5S)-5-[[(2R)-2-(1H-indol-3-ylmethyl)-4-oxopentanoyl]amino]-2,6-dioxo-6-propan-2-yloxyhexylidene]-methylideneazanium |
|---|---|
| PubChem CID | 149073247 |
| Molecular Formula | C24H30N3O5+ |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | [(5S)-5-[[(2R)-2-(1H-indol-3-ylmethyl)-4-oxopentanoyl]amino]-2,6-dioxo-6-propan-2-yloxyhexylidene]-methylideneazanium |
| SMILES | C=[N+]=CC(=O)CC[C@H](NC(=O)[C@@H](CC(C)=O)Cc1c[nH]c2ccccc12)C(=O)OC(C)C |
| InChI | InChI=1S/C24H29N3O5/c1-15(2)32-24(31)22(10-9-19(29)14-25-4)27-23(30)17(11-16(3)28)12-18-13-26-21-8-6-5-7-20(18)21/h5-8,13-15,17,22,26H,4,9-12H2,1-3H3/p+1/t17-,22-/m0/s1 |
| InChIKey | QOKBSZQJQZHWKZ-JTSKRJEESA-O |
| XLogP | 1.93 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|