C27H36N6O6 — CID 150121799
propan-2-yl 2-[[6-acetamido-2-[[2-(1H-indol-3-yl)acetyl]amino]hexanoyl]amino]-6-diazo-5-oxohexanoate (PubChem CID 150121799) has the molecular formula C27H36N6O6 and a molecular weight of 540.62 g/mol. Its IUPAC name is propan-2-yl 2-[[6-acetamido-2-[[2-(1H-indol-3-yl)acetyl]amino]hexanoyl]amino]-6-diazo-5-oxohexanoate.
| Compound Name | propan-2-yl 2-[[6-acetamido-2-[[2-(1H-indol-3-yl)acetyl]amino]hexanoyl]amino]-6-diazo-5-oxohexanoate |
|---|---|
| PubChem CID | 150121799 |
| Molecular Formula | C27H36N6O6 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | propan-2-yl 2-[[6-acetamido-2-[[2-(1H-indol-3-yl)acetyl]amino]hexanoyl]amino]-6-diazo-5-oxohexanoate |
| SMILES | CC(=O)NCCCCC(NC(=O)Cc1c[nH]c2ccccc12)C(=O)NC(CCC(=O)C=[N+]=[N-])C(=O)OC(C)C |
| InChI | InChI=1S/C27H36N6O6/c1-17(2)39-27(38)24(12-11-20(35)16-31-28)33-26(37)23(10-6-7-13-29-18(3)34)32-25(36)14-19-15-30-22-9-5-4-8-21(19)22/h4-5,8-9,15-17,23-24,30H,6-7,10-14H2,1-3H3,(H,29,34)(H,32,36)(H,33,37) |
| InChIKey | DZKAKWKDADAPIW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 182.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|