C21H30N4O3 — CID 10091557
(2S)-N-(6-acetamidohexyl)-2-[[2-(1H-indol-3-yl)acetyl]amino]propanamide (PubChem CID 10091557) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is (2S)-N-(6-acetamidohexyl)-2-[[2-(1H-indol-3-yl)acetyl]amino]propanamide.
| Compound Name | (2S)-N-(6-acetamidohexyl)-2-[[2-(1H-indol-3-yl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 10091557 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | (2S)-N-(6-acetamidohexyl)-2-[[2-(1H-indol-3-yl)acetyl]amino]propanamide |
| SMILES | CC(=O)NCCCCCCNC(=O)[C@H](C)NC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H30N4O3/c1-15(21(28)23-12-8-4-3-7-11-22-16(2)26)25-20(27)13-17-14-24-19-10-6-5-9-18(17)19/h5-6,9-10,14-15,24H,3-4,7-8,11-13H2,1-2H3,(H,22,26)(H,23,28)(H,25,27)/t15-/m0/s1 |
| InChIKey | XRXRXUHJWYGPRY-HNNXBMFYSA-N |
| XLogP | 2.03 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|