C28H40N6O8 — CID 164945209
propan-2-yl 2-[[6-acetamido-2-[[2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-6-diazo-5-oxohexanoate (PubChem CID 164945209) has the molecular formula C28H40N6O8 and a molecular weight of 588.66 g/mol. Its IUPAC name is propan-2-yl 2-[[6-acetamido-2-[[2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-6-diazo-5-oxohexanoate.
| Compound Name | propan-2-yl 2-[[6-acetamido-2-[[2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-6-diazo-5-oxohexanoate |
|---|---|
| PubChem CID | 164945209 |
| Molecular Formula | C28H40N6O8 |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | propan-2-yl 2-[[6-acetamido-2-[[2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-6-diazo-5-oxohexanoate |
| SMILES | CC(=O)NCCCCC(NC(=O)C(Cc1ccc(O)cc1)NC(C)=O)C(=O)NC(CCC(=O)C=[N+]=[N-])C(=O)OC(C)C |
| InChI | InChI=1S/C28H40N6O8/c1-17(2)42-28(41)24(13-12-22(38)16-31-29)34-26(39)23(7-5-6-14-30-18(3)35)33-27(40)25(32-19(4)36)15-20-8-10-21(37)11-9-20/h8-11,16-17,23-25,37H,5-7,12-15H2,1-4H3,(H,30,35)(H,32,36)(H,33,40)(H,34,39) |
| InChIKey | ALJANVYPVVYEIJ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 216.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|