C13H19N3O6 — CID 170443687
propan-2-yl (2S)-6-diazo-2-[[(2R)-2-hydroxy-3-oxobutanoyl]amino]-5-oxohexanoate (PubChem CID 170443687) has the molecular formula C13H19N3O6 and a molecular weight of 313.31 g/mol. Its IUPAC name is propan-2-yl (2S)-6-diazo-2-[[(2R)-2-hydroxy-3-oxobutanoyl]amino]-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-6-diazo-2-[[(2R)-2-hydroxy-3-oxobutanoyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 170443687 |
| Molecular Formula | C13H19N3O6 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | propan-2-yl (2S)-6-diazo-2-[[(2R)-2-hydroxy-3-oxobutanoyl]amino]-5-oxohexanoate |
| SMILES | CC(=O)[C@@H](O)C(=O)N[C@@H](CCC(=O)C=[N+]=[N-])C(=O)OC(C)C |
| InChI | InChI=1S/C13H19N3O6/c1-7(2)22-13(21)10(5-4-9(18)6-15-14)16-12(20)11(19)8(3)17/h6-7,10-11,19H,4-5H2,1-3H3,(H,16,20)/t10-,11+/m0/s1 |
| InChIKey | GGIMPXARLNEJLP-WDEREUQCSA-N |
| XLogP | -0.98 |
| TPSA | 146.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|