C15H25N3O5 — CID 170443655
propan-2-yl (2S)-6-diazo-2-[[(2R,3S)-3-methoxy-2-methylbutanoyl]amino]-5-oxohexanoate (PubChem CID 170443655) has the molecular formula C15H25N3O5 and a molecular weight of 327.38 g/mol. Its IUPAC name is propan-2-yl (2S)-6-diazo-2-[[(2R,3S)-3-methoxy-2-methylbutanoyl]amino]-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-6-diazo-2-[[(2R,3S)-3-methoxy-2-methylbutanoyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 170443655 |
| Molecular Formula | C15H25N3O5 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | propan-2-yl (2S)-6-diazo-2-[[(2R,3S)-3-methoxy-2-methylbutanoyl]amino]-5-oxohexanoate |
| SMILES | CO[C@@H](C)[C@@H](C)C(=O)N[C@@H](CCC(=O)C=[N+]=[N-])C(=O)OC(C)C |
| InChI | InChI=1S/C15H25N3O5/c1-9(2)23-15(21)13(7-6-12(19)8-17-16)18-14(20)10(3)11(4)22-5/h8-11,13H,6-7H2,1-5H3,(H,18,20)/t10-,11+,13+/m1/s1 |
| InChIKey | PYGIOPQVEPZXIP-MDZLAQPJSA-N |
| XLogP | 0.74 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|