C18H23N3O6 — CID 170436681
(2S)-6-diazo-2-[[(2S)-3-(4-hydroxyphenyl)-2-propan-2-yloxypropanoyl]amino]-5-oxohexanoic acid (PubChem CID 170436681) has the molecular formula C18H23N3O6 and a molecular weight of 377.40 g/mol. Its IUPAC name is (2S)-6-diazo-2-[[(2S)-3-(4-hydroxyphenyl)-2-propan-2-yloxypropanoyl]amino]-5-oxohexanoic acid.
| Compound Name | (2S)-6-diazo-2-[[(2S)-3-(4-hydroxyphenyl)-2-propan-2-yloxypropanoyl]amino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 170436681 |
| Molecular Formula | C18H23N3O6 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (2S)-6-diazo-2-[[(2S)-3-(4-hydroxyphenyl)-2-propan-2-yloxypropanoyl]amino]-5-oxohexanoic acid |
| SMILES | CC(C)O[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCC(=O)C=[N+]=[N-])C(=O)O |
| InChI | InChI=1S/C18H23N3O6/c1-11(2)27-16(9-12-3-5-13(22)6-4-12)17(24)21-15(18(25)26)8-7-14(23)10-20-19/h3-6,10-11,15-16,22H,7-9H2,1-2H3,(H,21,24)(H,25,26)/t15-,16-/m0/s1 |
| InChIKey | AGITYNBRZFUBFQ-HOTGVXAUSA-N |
| XLogP | 0.95 |
| TPSA | 149.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|