C11H17N3O5 — CID 170437165
(2S)-6-diazo-2-[[(2S)-2-hydroxypentanoyl]amino]-5-oxohexanoic acid (PubChem CID 170437165) has the molecular formula C11H17N3O5 and a molecular weight of 271.27 g/mol. Its IUPAC name is (2S)-6-diazo-2-[[(2S)-2-hydroxypentanoyl]amino]-5-oxohexanoic acid.
| Compound Name | (2S)-6-diazo-2-[[(2S)-2-hydroxypentanoyl]amino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 170437165 |
| Molecular Formula | C11H17N3O5 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (2S)-6-diazo-2-[[(2S)-2-hydroxypentanoyl]amino]-5-oxohexanoic acid |
| SMILES | CCC[C@H](O)C(=O)N[C@@H](CCC(=O)C=[N+]=[N-])C(=O)O |
| InChI | InChI=1S/C11H17N3O5/c1-2-3-9(16)10(17)14-8(11(18)19)5-4-7(15)6-13-12/h6,8-9,16H,2-5H2,1H3,(H,14,17)(H,18,19)/t8-,9-/m0/s1 |
| InChIKey | BVXVKYLWLWXLDN-IUCAKERBSA-N |
| XLogP | -0.63 |
| TPSA | 140.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|