C13H21N3O5 — CID 170437092
(2S)-6-diazo-2-[[(2S)-2-methoxy-3,3-dimethylbutanoyl]amino]-5-oxohexanoic acid (PubChem CID 170437092) has the molecular formula C13H21N3O5 and a molecular weight of 299.33 g/mol. Its IUPAC name is (2S)-6-diazo-2-[[(2S)-2-methoxy-3,3-dimethylbutanoyl]amino]-5-oxohexanoic acid.
| Compound Name | (2S)-6-diazo-2-[[(2S)-2-methoxy-3,3-dimethylbutanoyl]amino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 170437092 |
| Molecular Formula | C13H21N3O5 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (2S)-6-diazo-2-[[(2S)-2-methoxy-3,3-dimethylbutanoyl]amino]-5-oxohexanoic acid |
| SMILES | CO[C@H](C(=O)N[C@@H](CCC(=O)C=[N+]=[N-])C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C13H21N3O5/c1-13(2,3)10(21-4)11(18)16-9(12(19)20)6-5-8(17)7-15-14/h7,9-10H,5-6H2,1-4H3,(H,16,18)(H,19,20)/t9-,10+/m0/s1 |
| InChIKey | STLCERCHUNRZPX-VHSXEESVSA-N |
| XLogP | 0.27 |
| TPSA | 129.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|