C12H15N5O5 — CID 170436873
6-diazo-2-[[2-(1H-imidazol-2-yl)-2-methoxyacetyl]amino]-5-oxohexanoic acid (PubChem CID 170436873) has the molecular formula C12H15N5O5 and a molecular weight of 309.28 g/mol. Its IUPAC name is 6-diazo-2-[[2-(1H-imidazol-2-yl)-2-methoxyacetyl]amino]-5-oxohexanoic acid.
| Compound Name | 6-diazo-2-[[2-(1H-imidazol-2-yl)-2-methoxyacetyl]amino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 170436873 |
| Molecular Formula | C12H15N5O5 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 6-diazo-2-[[2-(1H-imidazol-2-yl)-2-methoxyacetyl]amino]-5-oxohexanoic acid |
| SMILES | COC(C(=O)NC(CCC(=O)C=[N+]=[N-])C(=O)O)c1ncc[nH]1 |
| InChI | InChI=1S/C12H15N5O5/c1-22-9(10-14-4-5-15-10)11(19)17-8(12(20)21)3-2-7(18)6-16-13/h4-6,8-9H,2-3H2,1H3,(H,14,15)(H,17,19)(H,20,21) |
| InChIKey | PQPIELVOMOGJLE-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 157.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|