C12H19N3O5 — CID 170436974
6-diazo-2-(2-methoxypentanoylamino)-5-oxohexanoic acid (PubChem CID 170436974) has the molecular formula C12H19N3O5 and a molecular weight of 285.30 g/mol. Its IUPAC name is 6-diazo-2-(2-methoxypentanoylamino)-5-oxohexanoic acid.
| Compound Name | 6-diazo-2-(2-methoxypentanoylamino)-5-oxohexanoic acid |
|---|---|
| PubChem CID | 170436974 |
| Molecular Formula | C12H19N3O5 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 6-diazo-2-(2-methoxypentanoylamino)-5-oxohexanoic acid |
| SMILES | CCCC(OC)C(=O)NC(CCC(=O)C=[N+]=[N-])C(=O)O |
| InChI | InChI=1S/C12H19N3O5/c1-3-4-10(20-2)11(17)15-9(12(18)19)6-5-8(16)7-14-13/h7,9-10H,3-6H2,1-2H3,(H,15,17)(H,18,19) |
| InChIKey | RTSBYBXFBRHQBS-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 129.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|