C10H15N3O4S — CID 170436878
6-diazo-2-(2-methoxypropanoylamino)-5-oxohexanethioic S-acid (PubChem CID 170436878) has the molecular formula C10H15N3O4S and a molecular weight of 273.31 g/mol. Its IUPAC name is 6-diazo-2-(2-methoxypropanoylamino)-5-oxohexanethioic S-acid.
| Compound Name | 6-diazo-2-(2-methoxypropanoylamino)-5-oxohexanethioic S-acid |
|---|---|
| PubChem CID | 170436878 |
| Molecular Formula | C10H15N3O4S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 6-diazo-2-(2-methoxypropanoylamino)-5-oxohexanethioic S-acid |
| SMILES | COC(C)C(=O)NC(CCC(=O)C=[N+]=[N-])C(=O)S |
| InChI | InChI=1S/C10H15N3O4S/c1-6(17-2)9(15)13-8(10(16)18)4-3-7(14)5-12-11/h5-6,8H,3-4H2,1-2H3,(H,13,15)(H,16,18) |
| InChIKey | JSEVAYQADWTGRS-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|