C12H19N3O5 — CID 170532483
1,1,2,2,2-pentadeuterioethyl (2S)-6-diazo-2-[[(2S)-2-methoxypropanoyl]amino]-5-oxohexanoate (PubChem CID 170532483) has the molecular formula C12H19N3O5 and a molecular weight of 290.33 g/mol. Its IUPAC name is 1,1,2,2,2-pentadeuterioethyl (2S)-6-diazo-2-[[(2S)-2-methoxypropanoyl]amino]-5-oxohexanoate.
| Compound Name | 1,1,2,2,2-pentadeuterioethyl (2S)-6-diazo-2-[[(2S)-2-methoxypropanoyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 170532483 |
| Molecular Formula | C12H19N3O5 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 1,1,2,2,2-pentadeuterioethyl (2S)-6-diazo-2-[[(2S)-2-methoxypropanoyl]amino]-5-oxohexanoate |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC(=O)[C@H](CCC(=O)C=[N+]=[N-])NC(=O)[C@H](C)OC |
| InChI | InChI=1S/C12H19N3O5/c1-4-20-12(18)10(6-5-9(16)7-14-13)15-11(17)8(2)19-3/h7-8,10H,4-6H2,1-3H3,(H,15,17)/t8-,10-/m0/s1/i1D3,4D2 |
| InChIKey | CERMJBOCMXFIQJ-RXWMWGMSSA-N |
| XLogP | -0.28 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|