C15H22F3N3O5 — CID 170443857
(4,4,4-trifluoro-2-methylbutan-2-yl) (2S)-6-diazo-2-[[(2S)-2-methoxypropanoyl]amino]-5-oxohexanoate (PubChem CID 170443857) has the molecular formula C15H22F3N3O5 and a molecular weight of 381.35 g/mol. Its IUPAC name is (4,4,4-trifluoro-2-methylbutan-2-yl) (2S)-6-diazo-2-[[(2S)-2-methoxypropanoyl]amino]-5-oxohexanoate.
| Compound Name | (4,4,4-trifluoro-2-methylbutan-2-yl) (2S)-6-diazo-2-[[(2S)-2-methoxypropanoyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 170443857 |
| Molecular Formula | C15H22F3N3O5 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (4,4,4-trifluoro-2-methylbutan-2-yl) (2S)-6-diazo-2-[[(2S)-2-methoxypropanoyl]amino]-5-oxohexanoate |
| SMILES | CO[C@@H](C)C(=O)N[C@@H](CCC(=O)C=[N+]=[N-])C(=O)OC(C)(C)CC(F)(F)F |
| InChI | InChI=1S/C15H22F3N3O5/c1-9(25-4)12(23)21-11(6-5-10(22)7-20-19)13(24)26-14(2,3)8-15(16,17)18/h7,9,11H,5-6,8H2,1-4H3,(H,21,23)/t9-,11-/m0/s1 |
| InChIKey | PAFSTMDKWWXHGX-ONGXEEELSA-N |
| XLogP | 1.43 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|