C11H17N3O5S — CID 170532620
methyl (2S)-6-diazo-2-[[(2S)-2-methylsulfinylpropanoyl]amino]-5-oxohexanoate (PubChem CID 170532620) has the molecular formula C11H17N3O5S and a molecular weight of 303.34 g/mol. Its IUPAC name is methyl (2S)-6-diazo-2-[[(2S)-2-methylsulfinylpropanoyl]amino]-5-oxohexanoate.
| Compound Name | methyl (2S)-6-diazo-2-[[(2S)-2-methylsulfinylpropanoyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 170532620 |
| Molecular Formula | C11H17N3O5S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | methyl (2S)-6-diazo-2-[[(2S)-2-methylsulfinylpropanoyl]amino]-5-oxohexanoate |
| SMILES | COC(=O)[C@H](CCC(=O)C=[N+]=[N-])NC(=O)[C@H](C)S(C)=O |
| InChI | InChI=1S/C11H17N3O5S/c1-7(20(3)18)10(16)14-9(11(17)19-2)5-4-8(15)6-13-12/h6-7,9H,4-5H2,1-3H3,(H,14,16)/t7-,9-,20?/m0/s1 |
| InChIKey | DATOOHLWSBZSLC-WVEBTQTCSA-N |
| XLogP | -0.94 |
| TPSA | 125.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|