C11H18N3O5S+ — CID 170532485
(E)-imino-[(5S)-6-methoxy-5-[[(2S)-2-methylsulfinylpropanoyl]amino]-2,6-dioxohexylidene]azanium (PubChem CID 170532485) has the molecular formula C11H18N3O5S+ and a molecular weight of 304.35 g/mol. Its IUPAC name is (E)-imino-[(5S)-6-methoxy-5-[[(2S)-2-methylsulfinylpropanoyl]amino]-2,6-dioxohexylidene]azanium.
| Compound Name | (E)-imino-[(5S)-6-methoxy-5-[[(2S)-2-methylsulfinylpropanoyl]amino]-2,6-dioxohexylidene]azanium |
|---|---|
| PubChem CID | 170532485 |
| Molecular Formula | C11H18N3O5S+ |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | (E)-imino-[(5S)-6-methoxy-5-[[(2S)-2-methylsulfinylpropanoyl]amino]-2,6-dioxohexylidene]azanium |
| SMILES | COC(=O)[C@H](CCC(=O)C=[N+]=N)NC(=O)[C@H](C)S(C)=O |
| InChI | InChI=1S/C11H17N3O5S/c1-7(20(3)18)10(16)14-9(11(17)19-2)5-4-8(15)6-13-12/h6-7,9,12H,4-5H2,1-3H3/p+1/t7-,9-,20?/m0/s1 |
| InChIKey | AXDGHGGSDVCEME-WVEBTQTCSA-O |
| XLogP | -0.93 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|