C20H36N5O5+ — CID 145243961
[(5S)-5-[[(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-6-ethoxy-2,6-dioxohexylidene]-iminoazanium (PubChem CID 145243961) has the molecular formula C20H36N5O5+ and a molecular weight of 426.54 g/mol. Its IUPAC name is [(5S)-5-[[(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-6-ethoxy-2,6-dioxohexylidene]-iminoazanium.
| Compound Name | [(5S)-5-[[(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-6-ethoxy-2,6-dioxohexylidene]-iminoazanium |
|---|---|
| PubChem CID | 145243961 |
| Molecular Formula | C20H36N5O5+ |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | [(5S)-5-[[(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-6-ethoxy-2,6-dioxohexylidene]-iminoazanium |
| SMILES | CCOC(=O)[C@H](CCC(=O)C=[N+]=N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C20H35N5O5/c1-6-30-20(29)16(8-7-14(26)11-23-22)24-19(28)17(10-13(4)5)25-18(27)15(21)9-12(2)3/h11-13,15-17,22H,6-10,21H2,1-5H3,(H-,24,25,27,28)/p+1/t15-,16-,17-/m0/s1 |
| InChIKey | JDFYRDJHFHCOJY-ULQDDVLXSA-O |
| XLogP | 0.60 |
| TPSA | 165.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|