C20H37N3O5 — CID 135301381
ethyl 2-[[2-[(2-amino-4-methylpentanoyl)amino]-4-methylpentanoyl]amino]-5-oxohexanoate (PubChem CID 135301381) has the molecular formula C20H37N3O5 and a molecular weight of 399.53 g/mol. Its IUPAC name is ethyl 2-[[2-[(2-amino-4-methylpentanoyl)amino]-4-methylpentanoyl]amino]-5-oxohexanoate.
| Compound Name | ethyl 2-[[2-[(2-amino-4-methylpentanoyl)amino]-4-methylpentanoyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 135301381 |
| Molecular Formula | C20H37N3O5 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | ethyl 2-[[2-[(2-amino-4-methylpentanoyl)amino]-4-methylpentanoyl]amino]-5-oxohexanoate |
| SMILES | CCOC(=O)C(CCC(C)=O)NC(=O)C(CC(C)C)NC(=O)C(N)CC(C)C |
| InChI | InChI=1S/C20H37N3O5/c1-7-28-20(27)16(9-8-14(6)24)22-19(26)17(11-13(4)5)23-18(25)15(21)10-12(2)3/h12-13,15-17H,7-11,21H2,1-6H3,(H,22,26)(H,23,25) |
| InChIKey | BQQPGESLQIWGAC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |