C12H20N3O4S+ — CID 170532599
(E)-[(5S)-6-ethoxy-5-[[(2S)-2-methylsulfanylpropanoyl]amino]-2,6-dioxohexylidene]-iminoazanium (PubChem CID 170532599) has the molecular formula C12H20N3O4S+ and a molecular weight of 302.38 g/mol. Its IUPAC name is (E)-[(5S)-6-ethoxy-5-[[(2S)-2-methylsulfanylpropanoyl]amino]-2,6-dioxohexylidene]-iminoazanium.
| Compound Name | (E)-[(5S)-6-ethoxy-5-[[(2S)-2-methylsulfanylpropanoyl]amino]-2,6-dioxohexylidene]-iminoazanium |
|---|---|
| PubChem CID | 170532599 |
| Molecular Formula | C12H20N3O4S+ |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (E)-[(5S)-6-ethoxy-5-[[(2S)-2-methylsulfanylpropanoyl]amino]-2,6-dioxohexylidene]-iminoazanium |
| SMILES | CCOC(=O)[C@H](CCC(=O)C=[N+]=N)NC(=O)[C@H](C)SC |
| InChI | InChI=1S/C12H19N3O4S/c1-4-19-12(18)10(6-5-9(16)7-14-13)15-11(17)8(2)20-3/h7-8,10,13H,4-6H2,1-3H3/p+1/t8-,10-/m0/s1 |
| InChIKey | UOYSUAWZZQNYTH-WPRPVWTQSA-O |
| XLogP | 0.45 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|