C19H24N5O4+ — CID 145243992
[(5S)-5-[[(2S)-2-amino-3-(1H-indol-2-yl)propanoyl]amino]-6-ethoxy-2,6-dioxohexylidene]-iminoazanium (PubChem CID 145243992) has the molecular formula C19H24N5O4+ and a molecular weight of 386.43 g/mol. Its IUPAC name is [(5S)-5-[[(2S)-2-amino-3-(1H-indol-2-yl)propanoyl]amino]-6-ethoxy-2,6-dioxohexylidene]-iminoazanium.
| Compound Name | [(5S)-5-[[(2S)-2-amino-3-(1H-indol-2-yl)propanoyl]amino]-6-ethoxy-2,6-dioxohexylidene]-iminoazanium |
|---|---|
| PubChem CID | 145243992 |
| Molecular Formula | C19H24N5O4+ |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | [(5S)-5-[[(2S)-2-amino-3-(1H-indol-2-yl)propanoyl]amino]-6-ethoxy-2,6-dioxohexylidene]-iminoazanium |
| SMILES | CCOC(=O)[C@H](CCC(=O)C=[N+]=N)NC(=O)[C@@H](N)Cc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H23N5O4/c1-2-28-19(27)17(8-7-14(25)11-22-21)24-18(26)15(20)10-13-9-12-5-3-4-6-16(12)23-13/h3-6,9,11,15,17,21,23H,2,7-8,10,20H2,1H3/p+1/t15-,17-/m0/s1 |
| InChIKey | JVOXQICZTGGNEL-RDJZCZTQSA-O |
| XLogP | 0.74 |
| TPSA | 152.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|