C17H20N2O3 — CID 89434536
ethyl N-[1-(1H-indol-2-yl)-4-methyl-3-oxopent-4-en-2-yl]carbamate (PubChem CID 89434536) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is ethyl N-[1-(1H-indol-2-yl)-4-methyl-3-oxopent-4-en-2-yl]carbamate.
| Compound Name | ethyl N-[1-(1H-indol-2-yl)-4-methyl-3-oxopent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 89434536 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | ethyl N-[1-(1H-indol-2-yl)-4-methyl-3-oxopent-4-en-2-yl]carbamate |
| SMILES | C=C(C)C(=O)C(Cc1cc2ccccc2[nH]1)NC(=O)OCC |
| InChI | InChI=1S/C17H20N2O3/c1-4-22-17(21)19-15(16(20)11(2)3)10-13-9-12-7-5-6-8-14(12)18-13/h5-9,15,18H,2,4,10H2,1,3H3,(H,19,21) |
| InChIKey | NHVUZQBVPKPBGZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|