C27H25N3O4 — CID 44591981
ethyl 2-[[2-(1H-indole-2-carbonylamino)benzoyl]amino]-3-phenylpropanoate (PubChem CID 44591981) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is ethyl 2-[[2-(1H-indole-2-carbonylamino)benzoyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl 2-[[2-(1H-indole-2-carbonylamino)benzoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 44591981 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | ethyl 2-[[2-(1H-indole-2-carbonylamino)benzoyl]amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1)NC(=O)c1ccccc1NC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C27H25N3O4/c1-2-34-27(33)24(16-18-10-4-3-5-11-18)30-25(31)20-13-7-9-15-22(20)29-26(32)23-17-19-12-6-8-14-21(19)28-23/h3-15,17,24,28H,2,16H2,1H3,(H,29,32)(H,30,31) |
| InChIKey | BZHUCSYAEOOMGB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |