C23H25N3O4S — CID 87055155
methyl (2R)-2-[[(2S)-2-(1H-indole-2-carbonylamino)-4-sulfanylbutanoyl]amino]-3-phenylpropanoate (PubChem CID 87055155) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is methyl (2R)-2-[[(2S)-2-(1H-indole-2-carbonylamino)-4-sulfanylbutanoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2R)-2-[[(2S)-2-(1H-indole-2-carbonylamino)-4-sulfanylbutanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 87055155 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | methyl (2R)-2-[[(2S)-2-(1H-indole-2-carbonylamino)-4-sulfanylbutanoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@H](CCS)NC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H25N3O4S/c1-30-23(29)20(13-15-7-3-2-4-8-15)26-21(27)18(11-12-31)25-22(28)19-14-16-9-5-6-10-17(16)24-19/h2-10,14,18,20,24,31H,11-13H2,1H3,(H,25,28)(H,26,27)/t18-,20+/m0/s1 |
| InChIKey | VJSFVXJINTXMPI-AZUAARDMSA-N |
| XLogP | 2.49 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|