C32H28N2O3S — CID 71183941
methyl 2-(1H-indole-2-carbonylamino)-3-tritylsulfanylpropanoate (PubChem CID 71183941) has the molecular formula C32H28N2O3S and a molecular weight of 520.65 g/mol. Its IUPAC name is methyl 2-(1H-indole-2-carbonylamino)-3-tritylsulfanylpropanoate.
| Compound Name | methyl 2-(1H-indole-2-carbonylamino)-3-tritylsulfanylpropanoate |
|---|---|
| PubChem CID | 71183941 |
| Molecular Formula | C32H28N2O3S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | methyl 2-(1H-indole-2-carbonylamino)-3-tritylsulfanylpropanoate |
| SMILES | COC(=O)C(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C32H28N2O3S/c1-37-31(36)29(34-30(35)28-21-23-13-11-12-20-27(23)33-28)22-38-32(24-14-5-2-6-15-24,25-16-7-3-8-17-25)26-18-9-4-10-19-26/h2-21,29,33H,22H2,1H3,(H,34,35) |
| InChIKey | RKJJSWPIMFLGFG-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|