C28H29NO3S — CID 11419785
methyl (2R)-2-(3-methylbut-2-enoylamino)-3-tritylsulfanylpropanoate (PubChem CID 11419785) has the molecular formula C28H29NO3S and a molecular weight of 459.61 g/mol. Its IUPAC name is methyl (2R)-2-(3-methylbut-2-enoylamino)-3-tritylsulfanylpropanoate.
| Compound Name | methyl (2R)-2-(3-methylbut-2-enoylamino)-3-tritylsulfanylpropanoate |
|---|---|
| PubChem CID | 11419785 |
| Molecular Formula | C28H29NO3S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | methyl (2R)-2-(3-methylbut-2-enoylamino)-3-tritylsulfanylpropanoate |
| SMILES | COC(=O)[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)C=C(C)C |
| InChI | InChI=1S/C28H29NO3S/c1-21(2)19-26(30)29-25(27(31)32-3)20-33-28(22-13-7-4-8-14-22,23-15-9-5-10-16-23)24-17-11-6-12-18-24/h4-19,25H,20H2,1-3H3,(H,29,30)/t25-/m0/s1 |
| InChIKey | SBOPKQUFJKABGM-VWLOTQADSA-N |
| XLogP | 5.34 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|