C46H43N3O4S2 — CID 138708247
[1-[[1-(methylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]amino]-1-oxo-3-tritylsulfanylpropan-2-yl] carbamate (PubChem CID 138708247) has the molecular formula C46H43N3O4S2 and a molecular weight of 766.00 g/mol. Its IUPAC name is [1-[[1-(methylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]amino]-1-oxo-3-tritylsulfanylpropan-2-yl] carbamate.
| Compound Name | [1-[[1-(methylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]amino]-1-oxo-3-tritylsulfanylpropan-2-yl] carbamate |
|---|---|
| PubChem CID | 138708247 |
| Molecular Formula | C46H43N3O4S2 |
| Molecular Weight | 766.00 g/mol |
| Exact Mass | 765.27 |
| IUPAC Name | [1-[[1-(methylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]amino]-1-oxo-3-tritylsulfanylpropan-2-yl] carbamate |
| SMILES | CNC(=O)C(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)C(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)OC(N)=O |
| InChI | InChI=1S/C46H43N3O4S2/c1-48-42(50)40(32-54-45(34-20-8-2-9-21-34,35-22-10-3-11-23-35)36-24-12-4-13-25-36)49-43(51)41(53-44(47)52)33-55-46(37-26-14-5-15-27-37,38-28-16-6-17-29-38)39-30-18-7-19-31-39/h2-31,40-41H,32-33H2,1H3,(H2,47,52)(H,48,50)(H,49,51) |
| InChIKey | DHWAWDREODVZLV-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.00 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|