C35H36N4O2S2 — CID 139669804
2-(1H-benzimidazol-2-ylmethylsulfanyl)-2-methyl-N-[(2R)-1-(methylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]propanamide (PubChem CID 139669804) has the molecular formula C35H36N4O2S2 and a molecular weight of 608.83 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylmethylsulfanyl)-2-methyl-N-[(2R)-1-(methylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]propanamide.
| Compound Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-2-methyl-N-[(2R)-1-(methylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]propanamide |
|---|---|
| PubChem CID | 139669804 |
| Molecular Formula | C35H36N4O2S2 |
| Molecular Weight | 608.83 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-2-methyl-N-[(2R)-1-(methylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]propanamide |
| SMILES | CNC(=O)[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)C(C)(C)SCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C35H36N4O2S2/c1-34(2,42-24-31-37-28-21-13-14-22-29(28)38-31)33(41)39-30(32(40)36-3)23-43-35(25-15-7-4-8-16-25,26-17-9-5-10-18-26)27-19-11-6-12-20-27/h4-22,30H,23-24H2,1-3H3,(H,36,40)(H,37,38)(H,39,41)/t30-/m0/s1 |
| InChIKey | VRVRIGVGAZBSLV-PMERELPUSA-N |
| XLogP | 6.53 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.83 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|