C45H43N3O2S2 — CID 138708285
(2R)-2-amino-N-[(2R)-1-(methylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]-3-tritylsulfanylpropanamide (PubChem CID 138708285) has the molecular formula C45H43N3O2S2 and a molecular weight of 721.99 g/mol. Its IUPAC name is (2R)-2-amino-N-[(2R)-1-(methylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]-3-tritylsulfanylpropanamide.
| Compound Name | (2R)-2-amino-N-[(2R)-1-(methylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]-3-tritylsulfanylpropanamide |
|---|---|
| PubChem CID | 138708285 |
| Molecular Formula | C45H43N3O2S2 |
| Molecular Weight | 721.99 g/mol |
| Exact Mass | 721.28 |
| IUPAC Name | (2R)-2-amino-N-[(2R)-1-(methylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]-3-tritylsulfanylpropanamide |
| SMILES | CNC(=O)[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)[C@@H](N)CSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H43N3O2S2/c1-47-43(50)41(33-52-45(37-26-14-5-15-27-37,38-28-16-6-17-29-38)39-30-18-7-19-31-39)48-42(49)40(46)32-51-44(34-20-8-2-9-21-34,35-22-10-3-11-23-35)36-24-12-4-13-25-36/h2-31,40-41H,32-33,46H2,1H3,(H,47,50)(H,48,49)/t40-,41-/m0/s1 |
| InChIKey | CHBFJLHOYMSKBN-YATWDLPUSA-N |
| XLogP | 8.00 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.99 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|