C46H43N3O4S — CID 175945312
(2S)-2-[[(2R)-2-amino-3-tritylsulfanylpropanoyl]amino]-5-oxo-5-(tritylamino)pentanoic acid (PubChem CID 175945312) has the molecular formula C46H43N3O4S and a molecular weight of 733.93 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-amino-3-tritylsulfanylpropanoyl]amino]-5-oxo-5-(tritylamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2R)-2-amino-3-tritylsulfanylpropanoyl]amino]-5-oxo-5-(tritylamino)pentanoic acid |
|---|---|
| PubChem CID | 175945312 |
| Molecular Formula | C46H43N3O4S |
| Molecular Weight | 733.93 g/mol |
| Exact Mass | 733.30 |
| IUPAC Name | (2S)-2-[[(2R)-2-amino-3-tritylsulfanylpropanoyl]amino]-5-oxo-5-(tritylamino)pentanoic acid |
| SMILES | N[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)N[C@@H](CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C46H43N3O4S/c47-40(33-54-46(37-25-13-4-14-26-37,38-27-15-5-16-28-38)39-29-17-6-18-30-39)43(51)48-41(44(52)53)31-32-42(50)49-45(34-19-7-1-8-20-34,35-21-9-2-10-22-35)36-23-11-3-12-24-36/h1-30,40-41H,31-33,47H2,(H,48,51)(H,49,50)(H,52,53)/t40-,41-/m0/s1 |
| InChIKey | ROGIUBIDDPQGTE-YATWDLPUSA-N |
| XLogP | 7.50 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.93 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|