C42H39N3O6 — CID 175894610
(2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]-5-oxo-5-(tritylamino)pentanoic acid (PubChem CID 175894610) has the molecular formula C42H39N3O6 and a molecular weight of 681.79 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]-5-oxo-5-(tritylamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]-5-oxo-5-(tritylamino)pentanoic acid |
|---|---|
| PubChem CID | 175894610 |
| Molecular Formula | C42H39N3O6 |
| Molecular Weight | 681.79 g/mol |
| Exact Mass | 681.28 |
| IUPAC Name | (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]-5-oxo-5-(tritylamino)pentanoic acid |
| SMILES | C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N[C@@H](CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C42H39N3O6/c1-28(43-41(50)51-27-36-34-23-13-11-21-32(34)33-22-12-14-24-35(33)36)39(47)44-37(40(48)49)25-26-38(46)45-42(29-15-5-2-6-16-29,30-17-7-3-8-18-30)31-19-9-4-10-20-31/h2-24,28,36-37H,25-27H2,1H3,(H,43,50)(H,44,47)(H,45,46)(H,48,49)/t28-,37-/m0/s1 |
| InChIKey | ZFJXSLBPYUPOBB-AIJWEMPKSA-N |
| XLogP | 6.37 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.79 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|