C43H41N3O6 — CID 175957409
2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(tritylamino)pentanoyl]amino]-2-methylpropanoic acid (PubChem CID 175957409) has the molecular formula C43H41N3O6 and a molecular weight of 695.82 g/mol. Its IUPAC name is 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(tritylamino)pentanoyl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(tritylamino)pentanoyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 175957409 |
| Molecular Formula | C43H41N3O6 |
| Molecular Weight | 695.82 g/mol |
| Exact Mass | 695.30 |
| IUPAC Name | 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(tritylamino)pentanoyl]amino]-2-methylpropanoic acid |
| SMILES | CC(C)(NC(=O)[C@H](CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C43H41N3O6/c1-42(2,40(49)50)46-39(48)37(44-41(51)52-28-36-34-24-14-12-22-32(34)33-23-13-15-25-35(33)36)26-27-38(47)45-43(29-16-6-3-7-17-29,30-18-8-4-9-19-30)31-20-10-5-11-21-31/h3-25,36-37H,26-28H2,1-2H3,(H,44,51)(H,45,47)(H,46,48)(H,49,50)/t37-/m0/s1 |
| InChIKey | FYWPPHSRBYQQEA-QNGWXLTQSA-N |
| XLogP | 6.76 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.82 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|