C46H41N3O5 — CID 167312927
9H-fluoren-9-ylmethyl N-[(2S)-1-[4-(hydroxymethyl)anilino]-1,5-dioxo-5-(tritylamino)pentan-2-yl]carbamate (PubChem CID 167312927) has the molecular formula C46H41N3O5 and a molecular weight of 715.85 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-1-[4-(hydroxymethyl)anilino]-1,5-dioxo-5-(tritylamino)pentan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-[4-(hydroxymethyl)anilino]-1,5-dioxo-5-(tritylamino)pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 167312927 |
| Molecular Formula | C46H41N3O5 |
| Molecular Weight | 715.85 g/mol |
| Exact Mass | 715.30 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-[4-(hydroxymethyl)anilino]-1,5-dioxo-5-(tritylamino)pentan-2-yl]carbamate |
| SMILES | O=C(CC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)Nc1ccc(CO)cc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C46H41N3O5/c50-30-32-24-26-36(27-25-32)47-44(52)42(48-45(53)54-31-41-39-22-12-10-20-37(39)38-21-11-13-23-40(38)41)28-29-43(51)49-46(33-14-4-1-5-15-33,34-16-6-2-7-17-34)35-18-8-3-9-19-35/h1-27,41-42,50H,28-31H2,(H,47,52)(H,48,53)(H,49,51)/t42-/m0/s1 |
| InChIKey | XFUKHJYWFOMGOO-WBCKFURZSA-N |
| XLogP | 7.91 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.85 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|