C50H47N5O5 — CID 127239879
9H-fluoren-9-ylmethyl N-[(2S)-1-[(2Z)-2-[1-[(4-methylphenyl)methylamino]-1-oxopropan-2-ylidene]hydrazinyl]-1,5-dioxo-5-(tritylamino)pentan-2-yl]carbamate (PubChem CID 127239879) has the molecular formula C50H47N5O5 and a molecular weight of 797.96 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-1-[(2Z)-2-[1-[(4-methylphenyl)methylamino]-1-oxopropan-2-ylidene]hydrazinyl]-1,5-dioxo-5-(tritylamino)pentan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-[(2Z)-2-[1-[(4-methylphenyl)methylamino]-1-oxopropan-2-ylidene]hydrazinyl]-1,5-dioxo-5-(tritylamino)pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 127239879 |
| Molecular Formula | C50H47N5O5 |
| Molecular Weight | 797.96 g/mol |
| Exact Mass | 797.36 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-[(2Z)-2-[1-[(4-methylphenyl)methylamino]-1-oxopropan-2-ylidene]hydrazinyl]-1,5-dioxo-5-(tritylamino)pentan-2-yl]carbamate |
| SMILES | C/C(=N/NC(=O)[C@H](CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCc1ccc(C)cc1 |
| InChI | InChI=1S/C50H47N5O5/c1-34-26-28-36(29-27-34)32-51-47(57)35(2)54-55-48(58)45(52-49(59)60-33-44-42-24-14-12-22-40(42)41-23-13-15-25-43(41)44)30-31-46(56)53-50(37-16-6-3-7-17-37,38-18-8-4-9-19-38)39-20-10-5-11-21-39/h3-29,44-45H,30-33H2,1-2H3,(H,51,57)(H,52,59)(H,53,56)(H,55,58)/b54-35-/t45-/m0/s1 |
| InChIKey | ASTJQFVIVLLGSJ-DIYYYOMMSA-N |
| XLogP | 7.90 |
| TPSA | 137.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.96 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|