C44H43N3O6 — CID 101393129
6-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(tritylamino)butanoyl]amino]hexanoic acid (PubChem CID 101393129) has the molecular formula C44H43N3O6 and a molecular weight of 709.84 g/mol. Its IUPAC name is 6-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(tritylamino)butanoyl]amino]hexanoic acid.
| Compound Name | 6-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(tritylamino)butanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 101393129 |
| Molecular Formula | C44H43N3O6 |
| Molecular Weight | 709.84 g/mol |
| Exact Mass | 709.32 |
| IUPAC Name | 6-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(tritylamino)butanoyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)[C@H](CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C44H43N3O6/c48-40(47-44(31-17-5-1-6-18-31,32-19-7-2-8-20-32)33-21-9-3-10-22-33)29-39(42(51)45-28-16-4-11-27-41(49)50)46-43(52)53-30-38-36-25-14-12-23-34(36)35-24-13-15-26-37(35)38/h1-3,5-10,12-15,17-26,38-39H,4,11,16,27-30H2,(H,45,51)(H,46,52)(H,47,48)(H,49,50)/t39-/m0/s1 |
| InChIKey | CQOXQBFVYMLYRJ-KDXMTYKHSA-N |
| XLogP | 7.15 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.84 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|