C40H34N2O6 — CID 101255450
methyl (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2,5-dioxo-5-(tritylamino)pentanoate (PubChem CID 101255450) has the molecular formula C40H34N2O6 and a molecular weight of 638.72 g/mol. Its IUPAC name is methyl (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2,5-dioxo-5-(tritylamino)pentanoate.
| Compound Name | methyl (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2,5-dioxo-5-(tritylamino)pentanoate |
|---|---|
| PubChem CID | 101255450 |
| Molecular Formula | C40H34N2O6 |
| Molecular Weight | 638.72 g/mol |
| Exact Mass | 638.24 |
| IUPAC Name | methyl (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2,5-dioxo-5-(tritylamino)pentanoate |
| SMILES | COC(=O)C(=O)[C@H](CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C40H34N2O6/c1-47-38(45)37(44)35(41-39(46)48-26-34-32-23-13-11-21-30(32)31-22-12-14-24-33(31)34)25-36(43)42-40(27-15-5-2-6-16-27,28-17-7-3-8-18-28)29-19-9-4-10-20-29/h2-24,34-35H,25-26H2,1H3,(H,41,46)(H,42,43)/t35-/m0/s1 |
| InChIKey | HBJIOQVQNYHNHD-DHUJRADRSA-N |
| XLogP | 6.13 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.72 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|