C42H40N4O6 — CID 146381788
2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(tritylamino)butanoyl]-methylamino]ethylcarbamic acid (PubChem CID 146381788) has the molecular formula C42H40N4O6 and a molecular weight of 696.80 g/mol. Its IUPAC name is 2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(tritylamino)butanoyl]-methylamino]ethylcarbamic acid.
| Compound Name | 2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(tritylamino)butanoyl]-methylamino]ethylcarbamic acid |
|---|---|
| PubChem CID | 146381788 |
| Molecular Formula | C42H40N4O6 |
| Molecular Weight | 696.80 g/mol |
| Exact Mass | 696.29 |
| IUPAC Name | 2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(tritylamino)butanoyl]-methylamino]ethylcarbamic acid |
| SMILES | CN(CCNC(=O)O)C(=O)[C@@H](CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C42H40N4O6/c1-46(26-25-43-40(49)50)39(48)37(44-41(51)52-28-36-34-23-13-11-21-32(34)33-22-12-14-24-35(33)36)27-38(47)45-42(29-15-5-2-6-16-29,30-17-7-3-8-18-30)31-19-9-4-10-20-31/h2-24,36-37,43H,25-28H2,1H3,(H,44,51)(H,45,47)(H,49,50)/t37-/m1/s1 |
| InChIKey | YNBZEWOAQIFACP-DIPNUNPCSA-N |
| XLogP | 6.12 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.80 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|